About 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate
2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate (PubChem CID 88731048) has the molecular formula C7H18N2O4PtS
and a molecular weight of 421.38 g/mol. Its IUPAC name is 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate.
Molecular Properties
| Compound Name | 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate |
| PubChem CID | 88731048 |
| Molecular Formula | C7H18N2O4PtS |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate |
| SMILES | CCC(CC)(CN)CN.O=S(=O)([O-])[O-].[Pt+2] |
| InChI | InChI=1S/C7H18N2.H2O4S.Pt/c1-3-7(4-2,5-8)6-9;1-5(2,3)4;/h3-6,8-9H2,1-2H3;(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | XHQFKMOWFLMGBQ-UHFFFAOYSA-L |
| XLogP | -0.63 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate?
The IUPAC name of 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate (CID 88731048) is 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate.
What is the SMILES notation for 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate?
The canonical SMILES for 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate is CCC(CC)(CN)CN.O=S(=O)([O-])[O-].[Pt+2].
What is the InChIKey of 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate?
The InChIKey is XHQFKMOWFLMGBQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H18N2.H2O4S.Pt/c1-3-7(4-2,5-8)6-9;1-5(2,3)4;/h3-6,8-9H2,1-2H3;(H2,1,2,3,4);/q;;+2/p-2.
What are the key properties of 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate?
2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate has a molecular weight of 421.38 g/mol, XLogP of -0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethylpropane-1,3-diamine;platinum(2+);sulfate is sourced from PubChem (CID 88731048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).