C13H28O4S4 — CID 88731056
1,3-bis(ethylsulfanyl)-2,2-bis[ethylsulfanyl(hydroxy)methyl]propane-1,3-diol (PubChem CID 88731056) has the molecular formula C13H28O4S4 and a molecular weight of 376.63 g/mol. Its IUPAC name is 1,3-bis(ethylsulfanyl)-2,2-bis[ethylsulfanyl(hydroxy)methyl]propane-1,3-diol.
| Compound Name | 1,3-bis(ethylsulfanyl)-2,2-bis[ethylsulfanyl(hydroxy)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 88731056 |
| Molecular Formula | C13H28O4S4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1,3-bis(ethylsulfanyl)-2,2-bis[ethylsulfanyl(hydroxy)methyl]propane-1,3-diol |
| SMILES | CCSC(O)C(C(O)SCC)(C(O)SCC)C(O)SCC |
| InChI | InChI=1S/C13H28O4S4/c1-5-18-9(14)13(10(15)19-6-2,11(16)20-7-3)12(17)21-8-4/h9-12,14-17H,5-8H2,1-4H3 |
| InChIKey | HMLZUECIZANWDN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|