C14H16N2O — CID 88731339
N-(10-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),11-trien-5-ylidene)hydroxylamine (PubChem CID 88731339) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is N-(10-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),11-trien-5-ylidene)hydroxylamine.
| Compound Name | N-(10-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),11-trien-5-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 88731339 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-(10-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),11-trien-5-ylidene)hydroxylamine |
| SMILES | ON=C1CCC2=C1CC1CNC3=CCCC2=C31 |
| InChI | InChI=1S/C14H16N2O/c17-16-12-5-4-9-10-2-1-3-13-14(10)8(7-15-13)6-11(9)12/h3,8,15,17H,1-2,4-7H2 |
| InChIKey | BQAFFOIAJNPZQU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|