About 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide
4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide (PubChem CID 88731629) has the molecular formula C14H20Cl2N2O4S
and a molecular weight of 383.30 g/mol. Its IUPAC name is 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide.
Molecular Properties
| Compound Name | 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide |
| PubChem CID | 88731629 |
| Molecular Formula | C14H20Cl2N2O4S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide |
| SMILES | CCn1c(C)[n+](CCCCS(=O)(=O)O)c2cc(Cl)c(Cl)cc21.[OH-] |
| InChI | InChI=1S/C14H18Cl2N2O3S.H2O/c1-3-17-10(2)18(6-4-5-7-22(19,20)21)14-9-12(16)11(15)8-13(14)17;/h8-9H,3-7H2,1-2H3;1H2 |
| InChIKey | YGTXQOAIXLRSGR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide?
The IUPAC name of 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide (CID 88731629) is 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide.
What is the SMILES notation for 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide?
The canonical SMILES for 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide is CCn1c(C)[n+](CCCCS(=O)(=O)O)c2cc(Cl)c(Cl)cc21.[OH-].
What is the InChIKey of 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide?
The InChIKey is YGTXQOAIXLRSGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O3S.H2O/c1-3-17-10(2)18(6-4-5-7-22(19,20)21)14-9-12(16)11(15)8-13(14)17;/h8-9H,3-7H2,1-2H3;1H2.
What are the key properties of 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide?
4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide has a molecular weight of 383.30 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dichloro-3-ethyl-2-methylbenzimidazol-1-ium-1-yl)butane-1-sulfonic acid hydroxide is sourced from PubChem (CID 88731629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).