About (Z)-2,3-dibutylbut-2-enedioate;lead(2+)
(Z)-2,3-dibutylbut-2-enedioate;lead(2+) (PubChem CID 88732061) has the molecular formula C12H18O4Pb
and a molecular weight of 433.47 g/mol. Its IUPAC name is (Z)-2,3-dibutylbut-2-enedioate;lead(2+).
Molecular Properties
| Compound Name | (Z)-2,3-dibutylbut-2-enedioate;lead(2+) |
| PubChem CID | 88732061 |
| Molecular Formula | C12H18O4Pb |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (Z)-2,3-dibutylbut-2-enedioate;lead(2+) |
| SMILES | CCCC/C(C(=O)[O-])=C(\CCCC)C(=O)[O-].[Pb+2] |
| InChI | InChI=1S/C12H20O4.Pb/c1-3-5-7-9(11(13)14)10(12(15)16)8-6-4-2;/h3-8H2,1-2H3,(H,13,14)(H,15,16);/q;+2/p-2/b10-9-; |
| InChIKey | GKTLJJLUGQKYLQ-KVVVOXFISA-L |
| XLogP | -0.22 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dibutylbut-2-enedioate;lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dibutylbut-2-enedioate;lead(2+)?
The IUPAC name of (Z)-2,3-dibutylbut-2-enedioate;lead(2+) (CID 88732061) is (Z)-2,3-dibutylbut-2-enedioate;lead(2+).
What is the SMILES notation for (Z)-2,3-dibutylbut-2-enedioate;lead(2+)?
The canonical SMILES for (Z)-2,3-dibutylbut-2-enedioate;lead(2+) is CCCC/C(C(=O)[O-])=C(\CCCC)C(=O)[O-].[Pb+2].
What is the InChIKey of (Z)-2,3-dibutylbut-2-enedioate;lead(2+)?
The InChIKey is GKTLJJLUGQKYLQ-KVVVOXFISA-L. The full InChI is InChI=1S/C12H20O4.Pb/c1-3-5-7-9(11(13)14)10(12(15)16)8-6-4-2;/h3-8H2,1-2H3,(H,13,14)(H,15,16);/q;+2/p-2/b10-9-;.
What are the key properties of (Z)-2,3-dibutylbut-2-enedioate;lead(2+)?
(Z)-2,3-dibutylbut-2-enedioate;lead(2+) has a molecular weight of 433.47 g/mol, XLogP of -0.22, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dibutylbut-2-enedioate;lead(2+) is sourced from PubChem (CID 88732061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).