C12H15N4O3S+ — CID 88732197
(6R)-7-amino-8-oxo-3-(pyrazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88732197) has the molecular formula C12H15N4O3S+ and a molecular weight of 295.34 g/mol. Its IUPAC name is (6R)-7-amino-8-oxo-3-(pyrazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-amino-8-oxo-3-(pyrazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88732197 |
| Molecular Formula | C12H15N4O3S+ |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (6R)-7-amino-8-oxo-3-(pyrazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | NC1C(=O)N2CC(C[n+]3ccncc3)(C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C12H14N4O3S/c13-8-9(17)16-6-12(11(18)19,7-20-10(8)16)5-15-3-1-14-2-4-15/h1-4,8,10H,5-7,13H2/p+1/t8?,10-,12?/m1/s1 |
| InChIKey | VJEUWYXFBYGMAD-KRBLXSNTSA-O |
| XLogP | -1.32 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|