C21H18N6O7S — CID 88732811
(6S)-7-[[2-(5-amino-1,2-oxazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[3,2-c]pyridin-5-ium-5-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88732811) has the molecular formula C21H18N6O7S and a molecular weight of 498.48 g/mol. Its IUPAC name is (6S)-7-[[2-(5-amino-1,2-oxazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[3,2-c]pyridin-5-ium-5-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-7-[[2-(5-amino-1,2-oxazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[3,2-c]pyridin-5-ium-5-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88732811 |
| Molecular Formula | C21H18N6O7S |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | (6S)-7-[[2-(5-amino-1,2-oxazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(furo[3,2-c]pyridin-5-ium-5-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3ccc4occc4c3)CS[C@@H]12)c1cc(N)on1 |
| InChI | InChI=1S/C21H18N6O7S/c1-32-25-15(12-6-14(22)34-24-12)18(28)23-16-19(29)27-17(21(30)31)11(9-35-20(16)27)8-26-4-2-13-10(7-26)3-5-33-13/h2-7,16,20H,8-9H2,1H3,(H3-,22,23,24,28,30,31)/t16?,20-/m0/s1 |
| InChIKey | DZDYSSRTDNYYQJ-FZCLLLDFSA-N |
| XLogP | -1.25 |
| TPSA | 180.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|