About 1-bromonaphtho[2,3-f]quinoline
1-bromonaphtho[2,3-f]quinoline (PubChem CID 88732930) has the molecular formula C17H10BrN
and a molecular weight of 308.18 g/mol. Its IUPAC name is 1-bromonaphtho[2,3-f]quinoline.
Molecular Properties
| Compound Name | 1-bromonaphtho[2,3-f]quinoline |
| PubChem CID | 88732930 |
| Molecular Formula | C17H10BrN |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 1-bromonaphtho[2,3-f]quinoline |
| SMILES | Brc1ccnc2ccc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C17H10BrN/c18-15-7-8-19-16-6-5-13-9-11-3-1-2-4-12(11)10-14(13)17(15)16/h1-10H |
| InChIKey | WCTCHPBRHUCKMW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-bromonaphtho[2,3-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromonaphtho[2,3-f]quinoline?
The IUPAC name of 1-bromonaphtho[2,3-f]quinoline (CID 88732930) is 1-bromonaphtho[2,3-f]quinoline.
What is the SMILES notation for 1-bromonaphtho[2,3-f]quinoline?
The canonical SMILES for 1-bromonaphtho[2,3-f]quinoline is Brc1ccnc2ccc3cc4ccccc4cc3c12.
What is the InChIKey of 1-bromonaphtho[2,3-f]quinoline?
The InChIKey is WCTCHPBRHUCKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10BrN/c18-15-7-8-19-16-6-5-13-9-11-3-1-2-4-12(11)10-14(13)17(15)16/h1-10H.
What are the key properties of 1-bromonaphtho[2,3-f]quinoline?
1-bromonaphtho[2,3-f]quinoline has a molecular weight of 308.18 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromonaphtho[2,3-f]quinoline is sourced from PubChem (CID 88732930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).