C18H18FN3O5S — CID 8873340
(6R)-2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 8873340) has the molecular formula C18H18FN3O5S and a molecular weight of 407.42 g/mol. Its IUPAC name is (6R)-2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 8873340 |
| Molecular Formula | C18H18FN3O5S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (6R)-2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=O)COc3cc(F)ccc3[N+](=O)[O-])c2C(N)=O)C1 |
| InChI | InChI=1S/C18H18FN3O5S/c1-9-2-4-11-14(6-9)28-18(16(11)17(20)24)21-15(23)8-27-13-7-10(19)3-5-12(13)22(25)26/h3,5,7,9H,2,4,6,8H2,1H3,(H2,20,24)(H,21,23)/t9-/m1/s1 |
| InChIKey | PIEYLCWMGPAUEI-SECBINFHSA-N |
| XLogP | 3.04 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|