C15H21FO3 — CID 88734437
4-[(E)-4-fluoro-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 88734437) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-[(E)-4-fluoro-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | 4-[(E)-4-fluoro-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 88734437 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-[(E)-4-fluoro-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)C(=O)/C=C/C1CCC2OC(=O)CC12 |
| InChI | InChI=1S/C15H21FO3/c1-2-3-4-12(16)13(17)7-5-10-6-8-14-11(10)9-15(18)19-14/h5,7,10-12,14H,2-4,6,8-9H2,1H3/b7-5+ |
| InChIKey | FLPAGUAVWUDYBU-FNORWQNLSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|