C9H4Cl10O4 — CID 88735478
1,2,3,4,5,6,7,7-octachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;dihydrochloride (PubChem CID 88735478) has the molecular formula C9H4Cl10O4 and a molecular weight of 530.66 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,7-octachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;dihydrochloride.
| Compound Name | 1,2,3,4,5,6,7,7-octachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 88735478 |
| Molecular Formula | C9H4Cl10O4 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 525.70 |
| IUPAC Name | 1,2,3,4,5,6,7,7-octachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)C1(Cl)C2(Cl)C(Cl)=C(Cl)C(Cl)(C2(Cl)Cl)C1(Cl)C(=O)O |
| InChI | InChI=1S/C9H2Cl8O4.2ClH/c10-1-2(11)6(13)8(15,4(20)21)7(14,3(18)19)5(1,12)9(6,16)17;;/h(H,18,19)(H,20,21);2*1H |
| InChIKey | PKCUWIQDUOCILZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|