About 3-diazopyrazole tetrafluoroborate
3-diazopyrazole tetrafluoroborate (PubChem CID 88735714) has the molecular formula C3H2BF4N4-
and a molecular weight of 180.88 g/mol. Its IUPAC name is 3-diazopyrazole tetrafluoroborate.
Molecular Properties
| Compound Name | 3-diazopyrazole tetrafluoroborate |
| PubChem CID | 88735714 |
| Molecular Formula | C3H2BF4N4- |
| Molecular Weight | 180.88 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 3-diazopyrazole tetrafluoroborate |
| SMILES | F[B-](F)(F)F.[N-]=[N+]=C1C=CN=N1 |
| InChI | InChI=1S/C3H2N4.BF4/c4-6-3-1-2-5-7-3;2-1(3,4)5/h1-2H;/q;-1 |
| InChIKey | PEMOWWVVORTRCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.88 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-diazopyrazole tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazopyrazole tetrafluoroborate?
The IUPAC name of 3-diazopyrazole tetrafluoroborate (CID 88735714) is 3-diazopyrazole tetrafluoroborate.
What is the SMILES notation for 3-diazopyrazole tetrafluoroborate?
The canonical SMILES for 3-diazopyrazole tetrafluoroborate is F[B-](F)(F)F.[N-]=[N+]=C1C=CN=N1.
What is the InChIKey of 3-diazopyrazole tetrafluoroborate?
The InChIKey is PEMOWWVVORTRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N4.BF4/c4-6-3-1-2-5-7-3;2-1(3,4)5/h1-2H;/q;-1.
What are the key properties of 3-diazopyrazole tetrafluoroborate?
3-diazopyrazole tetrafluoroborate has a molecular weight of 180.88 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazopyrazole tetrafluoroborate is sourced from PubChem (CID 88735714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).