C15H20O6 — CID 88736259
4-[1,4-dihydroxy-2-(hydroxymethyl)butan-2-yl]-4-prop-2-enoylhepta-1,6-diene-3,5-dione (PubChem CID 88736259) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-[1,4-dihydroxy-2-(hydroxymethyl)butan-2-yl]-4-prop-2-enoylhepta-1,6-diene-3,5-dione.
| Compound Name | 4-[1,4-dihydroxy-2-(hydroxymethyl)butan-2-yl]-4-prop-2-enoylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 88736259 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[1,4-dihydroxy-2-(hydroxymethyl)butan-2-yl]-4-prop-2-enoylhepta-1,6-diene-3,5-dione |
| SMILES | C=CC(=O)C(C(=O)C=C)(C(=O)C=C)C(CO)(CO)CCO |
| InChI | InChI=1S/C15H20O6/c1-4-11(19)15(12(20)5-2,13(21)6-3)14(9-17,10-18)7-8-16/h4-6,16-18H,1-3,7-10H2 |
| InChIKey | YWVNTEZZSIEBLH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|