About 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide
2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide (PubChem CID 88736329) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide |
| PubChem CID | 88736329 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(CC2CO2)c1 |
| InChI | InChI=1S/C11H12N2O3/c12-10(14)6-1-2-9(11(13)15)7(3-6)4-8-5-16-8/h1-3,8H,4-5H2,(H2,12,14)(H2,13,15) |
| InChIKey | WSKNRAATBZQAIE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide?
The IUPAC name of 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide (CID 88736329) is 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide.
What is the SMILES notation for 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide?
The canonical SMILES for 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide is NC(=O)c1ccc(C(N)=O)c(CC2CO2)c1.
What is the InChIKey of 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide?
The InChIKey is WSKNRAATBZQAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c12-10(14)6-1-2-9(11(13)15)7(3-6)4-8-5-16-8/h1-3,8H,4-5H2,(H2,12,14)(H2,13,15).
What are the key properties of 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide?
2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide has a molecular weight of 220.23 g/mol, XLogP of -0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethyl)benzene-1,4-dicarboxamide is sourced from PubChem (CID 88736329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).