About 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione
3-(1-propoxypropyl)-1,3-thiazolidine-2-thione (PubChem CID 88736842) has the molecular formula C9H17NOS2
and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione |
| PubChem CID | 88736842 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione |
| SMILES | CCCOC(CC)N1CCSC1=S |
| InChI | InChI=1S/C9H17NOS2/c1-3-6-11-8(4-2)10-5-7-13-9(10)12/h8H,3-7H2,1-2H3 |
| InChIKey | RXIWMCIQUBZFOZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione?
The IUPAC name of 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione (CID 88736842) is 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione.
What is the SMILES notation for 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione?
The canonical SMILES for 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione is CCCOC(CC)N1CCSC1=S.
What is the InChIKey of 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione?
The InChIKey is RXIWMCIQUBZFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS2/c1-3-6-11-8(4-2)10-5-7-13-9(10)12/h8H,3-7H2,1-2H3.
What are the key properties of 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione?
3-(1-propoxypropyl)-1,3-thiazolidine-2-thione has a molecular weight of 219.37 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-propoxypropyl)-1,3-thiazolidine-2-thione is sourced from PubChem (CID 88736842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).