C23H37N5O8S2Si — CID 88736979
[2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 88736979) has the molecular formula C23H37N5O8S2Si and a molecular weight of 603.80 g/mol. Its IUPAC name is [2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88736979 |
| Molecular Formula | C23H37N5O8S2Si |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N(C(=O)C(=O)OCOC(=O)C(C)(C)C)[C@@H]1SC(=O)CSc1nnnn1C |
| InChI | InChI=1S/C23H37N5O8S2Si/c1-13(36-39(9,10)23(5,6)7)15-16(30)28(17(31)19(32)34-12-35-20(33)22(2,3)4)18(15)38-14(29)11-37-21-24-25-26-27(21)8/h13,15,18H,11-12H2,1-10H3/t13-,15+,18+/m0/s1 |
| InChIKey | NKJWWGXBRXBJLM-JCKWVBRZSA-N |
| XLogP | 2.37 |
| TPSA | 159.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|