C12H20O4 — CID 88737356
1-[2-(oxepan-2-yl)-1,3-dioxolan-2-yl]propan-1-one (PubChem CID 88737356) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-[2-(oxepan-2-yl)-1,3-dioxolan-2-yl]propan-1-one.
| Compound Name | 1-[2-(oxepan-2-yl)-1,3-dioxolan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 88737356 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-[2-(oxepan-2-yl)-1,3-dioxolan-2-yl]propan-1-one |
| SMILES | CCC(=O)C1(C2CCCCCO2)OCCO1 |
| InChI | InChI=1S/C12H20O4/c1-2-10(13)12(15-8-9-16-12)11-6-4-3-5-7-14-11/h11H,2-9H2,1H3 |
| InChIKey | ARFZJOCYFYNWDC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |