About acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate
acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate (PubChem CID 88737843) has the molecular formula C20H34O6
and a molecular weight of 370.49 g/mol. Its IUPAC name is acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate.
Molecular Properties
| Compound Name | acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate |
| PubChem CID | 88737843 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate |
| SMILES | C=CC(CC)(CCOC(C)=O)OC(C=C)(CC)CCOC(C)=O.CC=O |
| InChI | InChI=1S/C18H30O5.C2H4O/c1-7-17(8-2,11-13-21-15(5)19)23-18(9-3,10-4)12-14-22-16(6)20;1-2-3/h7,9H,1,3,8,10-14H2,2,4-6H3;2H,1H3 |
| InChIKey | OCDZOHDAAQRVGE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate?
The IUPAC name of acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate (CID 88737843) is acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate.
What is the SMILES notation for acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate?
The canonical SMILES for acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate is C=CC(CC)(CCOC(C)=O)OC(C=C)(CC)CCOC(C)=O.CC=O.
What is the InChIKey of acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate?
The InChIKey is OCDZOHDAAQRVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O5.C2H4O/c1-7-17(8-2,11-13-21-15(5)19)23-18(9-3,10-4)12-14-22-16(6)20;1-2-3/h7,9H,1,3,8,10-14H2,2,4-6H3;2H,1H3.
What are the key properties of acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate?
acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate has a molecular weight of 370.49 g/mol, XLogP of 3.78, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;[3-(5-acetyloxy-3-ethylpent-1-en-3-yl)oxy-3-ethylpent-4-enyl] acetate is sourced from PubChem (CID 88737843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).