C13H15N2NaO8S2 — CID 88738499
sodium (5R,6S)-3-[(E)-2-acetamidoethenyl]sulfanyl-7-oxo-6-(1-sulfooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 88738499) has the molecular formula C13H15N2NaO8S2 and a molecular weight of 414.39 g/mol. Its IUPAC name is sodium (5R,6S)-3-[(E)-2-acetamidoethenyl]sulfanyl-7-oxo-6-(1-sulfooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | sodium (5R,6S)-3-[(E)-2-acetamidoethenyl]sulfanyl-7-oxo-6-(1-sulfooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88738499 |
| Molecular Formula | C13H15N2NaO8S2 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | sodium (5R,6S)-3-[(E)-2-acetamidoethenyl]sulfanyl-7-oxo-6-(1-sulfooxyethyl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC(=O)N/C=C/SC1=C(C(=O)O)N2C(=O)[C@H]([C-](C)OS(=O)(=O)O)[C@H]2C1.[Na+] |
| InChI | InChI=1S/C13H15N2O8S2.Na/c1-6(23-25(20,21)22)10-8-5-9(24-4-3-14-7(2)16)11(13(18)19)15(8)12(10)17;/h3-4,8,10H,5H2,1-2H3,(H,14,16)(H,18,19)(H,20,21,22);/q-1;+1/b4-3+;/t8-,10-;/m1./s1 |
| InChIKey | OEIQJEABARPZRE-IMEOJSFFSA-N |
| XLogP | -2.77 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|