C32H31N3O8S2 — CID 88738505
N-(3-hydroxyimino-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide;N-(3-oxo-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide (PubChem CID 88738505) has the molecular formula C32H31N3O8S2 and a molecular weight of 649.75 g/mol. Its IUPAC name is N-(3-hydroxyimino-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide;N-(3-oxo-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide.
| Compound Name | N-(3-hydroxyimino-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide;N-(3-oxo-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 88738505 |
| Molecular Formula | C32H31N3O8S2 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | N-(3-hydroxyimino-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide;N-(3-oxo-6-phenoxy-1,2-dihydroinden-5-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc2c(cc1Oc1ccccc1)CCC2=NO.CS(=O)(=O)Nc1cc2c(cc1Oc1ccccc1)CCC2=O |
| InChI | InChI=1S/C16H16N2O4S.C16H15NO4S/c1-23(20,21)18-15-10-13-11(7-8-14(13)17-19)9-16(15)22-12-5-3-2-4-6-12;1-22(19,20)17-14-10-13-11(7-8-15(13)18)9-16(14)21-12-5-3-2-4-6-12/h2-6,9-10,18-19H,7-8H2,1H3;2-6,9-10,17H,7-8H2,1H3 |
| InChIKey | DUBCFLHUZNRTJL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|