About (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate
(1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate (PubChem CID 88739377) has the molecular formula C5H7NO3S2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate.
Molecular Properties
| Compound Name | (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate |
| PubChem CID | 88739377 |
| Molecular Formula | C5H7NO3S2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 192.99 |
| IUPAC Name | (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate |
| SMILES | N#CC(CO)OC(=O)C(S)S |
| InChI | InChI=1S/C5H7NO3S2/c6-1-3(2-7)9-4(8)5(10)11/h3,5,7,10-11H,2H2 |
| InChIKey | LBDOVKTVOKCMIL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate?
The IUPAC name of (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate (CID 88739377) is (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate.
What is the SMILES notation for (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate?
The canonical SMILES for (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate is N#CC(CO)OC(=O)C(S)S.
What is the InChIKey of (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate?
The InChIKey is LBDOVKTVOKCMIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3S2/c6-1-3(2-7)9-4(8)5(10)11/h3,5,7,10-11H,2H2.
What are the key properties of (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate?
(1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate has a molecular weight of 193.25 g/mol, XLogP of -0.40, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-2-hydroxyethyl) 2,2-bis(sulfanyl)acetate is sourced from PubChem (CID 88739377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).