C31H39NO5S — CID 88739643
S-(methoxymethyl) (Z)-7-[(1R,2S)-2-morpholin-4-yl-3-oxo-4-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enethioate (PubChem CID 88739643) has the molecular formula C31H39NO5S and a molecular weight of 537.72 g/mol. Its IUPAC name is S-(methoxymethyl) (Z)-7-[(1R,2S)-2-morpholin-4-yl-3-oxo-4-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enethioate.
| Compound Name | S-(methoxymethyl) (Z)-7-[(1R,2S)-2-morpholin-4-yl-3-oxo-4-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enethioate |
|---|---|
| PubChem CID | 88739643 |
| Molecular Formula | C31H39NO5S |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | S-(methoxymethyl) (Z)-7-[(1R,2S)-2-morpholin-4-yl-3-oxo-4-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enethioate |
| SMILES | COCSC(=O)CC/C=C\CC[C@@H]1CC(OCc2ccc(-c3ccccc3)cc2)C(=O)[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C31H39NO5S/c1-35-23-38-29(33)12-8-3-2-5-11-27-21-28(31(34)30(27)32-17-19-36-20-18-32)37-22-24-13-15-26(16-14-24)25-9-6-4-7-10-25/h2-4,6-7,9-10,13-16,27-28,30H,5,8,11-12,17-23H2,1H3/b3-2-/t27-,28?,30+/m1/s1 |
| InChIKey | CMGQBHBYQFXVEU-CTCZGOBBSA-N |
| XLogP | 5.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|