C31H38N2O10S — CID 88740091
5-O-(2-methoxyethyl) 3-O-[6-(4-methylphenyl)sulfonyloxyhexyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88740091) has the molecular formula C31H38N2O10S and a molecular weight of 630.72 g/mol. Its IUPAC name is 5-O-(2-methoxyethyl) 3-O-[6-(4-methylphenyl)sulfonyloxyhexyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-methoxyethyl) 3-O-[6-(4-methylphenyl)sulfonyloxyhexyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88740091 |
| Molecular Formula | C31H38N2O10S |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 5-O-(2-methoxyethyl) 3-O-[6-(4-methylphenyl)sulfonyloxyhexyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCOS(=O)(=O)c2ccc(C)cc2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H38N2O10S/c1-21-13-15-24(16-14-21)44(38,39)43-18-10-6-5-9-17-41-30(34)27-22(2)32-23(3)28(31(35)42-20-19-40-4)29(27)25-11-7-8-12-26(25)33(36)37/h7-8,11-16,29,32H,5-6,9-10,17-20H2,1-4H3 |
| InChIKey | XNKZEWAHAXJMSZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|