About prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate
prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate (PubChem CID 88740284) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate.
Molecular Properties
| Compound Name | prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate |
| PubChem CID | 88740284 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate |
| SMILES | C=CC/N=C(/NC#N)SCC=C |
| InChI | InChI=1S/C8H11N3S/c1-3-5-10-8(11-7-9)12-6-4-2/h3-4H,1-2,5-6H2,(H,10,11) |
| InChIKey | CHJAVHHBAXFYSP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate?
The IUPAC name of prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate (CID 88740284) is prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate.
What is the SMILES notation for prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate?
The canonical SMILES for prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate is C=CC/N=C(/NC#N)SCC=C.
What is the InChIKey of prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate?
The InChIKey is CHJAVHHBAXFYSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-3-5-10-8(11-7-9)12-6-4-2/h3-4H,1-2,5-6H2,(H,10,11).
What are the key properties of prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate?
prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate has a molecular weight of 181.26 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-cyano-N'-prop-2-enylcarbamimidothioate is sourced from PubChem (CID 88740284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).