About carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane
carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane (PubChem CID 88740342) has the molecular formula C8H12Cl2O2
and a molecular weight of 211.09 g/mol. Its IUPAC name is carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane |
| PubChem CID | 88740342 |
| Molecular Formula | C8H12Cl2O2 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane |
| SMILES | C=C(Cl)C1CC1(C)C.O=C(O)Cl |
| InChI | InChI=1S/C7H11Cl.CHClO2/c1-5(8)6-4-7(6,2)3;2-1(3)4/h6H,1,4H2,2-3H3;(H,3,4) |
| InChIKey | UDNVQYWTGSIKFN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane?
The IUPAC name of carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane (CID 88740342) is carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane?
The canonical SMILES for carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane is C=C(Cl)C1CC1(C)C.O=C(O)Cl.
What is the InChIKey of carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane?
The InChIKey is UDNVQYWTGSIKFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Cl.CHClO2/c1-5(8)6-4-7(6,2)3;2-1(3)4/h6H,1,4H2,2-3H3;(H,3,4).
What are the key properties of carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane?
carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane has a molecular weight of 211.09 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonochloridic acid;2-(1-chloroethenyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 88740342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).