About 6-chloro-N,N,5-trimethylhexan-3-amine
6-chloro-N,N,5-trimethylhexan-3-amine (PubChem CID 88740860) has the molecular formula C9H20ClN
and a molecular weight of 177.72 g/mol. Its IUPAC name is 6-chloro-N,N,5-trimethylhexan-3-amine.
Molecular Properties
| Compound Name | 6-chloro-N,N,5-trimethylhexan-3-amine |
| PubChem CID | 88740860 |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 6-chloro-N,N,5-trimethylhexan-3-amine |
| SMILES | CCC(CC(C)CCl)N(C)C |
| InChI | InChI=1S/C9H20ClN/c1-5-9(11(3)4)6-8(2)7-10/h8-9H,5-7H2,1-4H3 |
| InChIKey | JVKAVRNWBGPDFS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.72 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N,N,5-trimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,N,5-trimethylhexan-3-amine?
The IUPAC name of 6-chloro-N,N,5-trimethylhexan-3-amine (CID 88740860) is 6-chloro-N,N,5-trimethylhexan-3-amine.
What is the SMILES notation for 6-chloro-N,N,5-trimethylhexan-3-amine?
The canonical SMILES for 6-chloro-N,N,5-trimethylhexan-3-amine is CCC(CC(C)CCl)N(C)C.
What is the InChIKey of 6-chloro-N,N,5-trimethylhexan-3-amine?
The InChIKey is JVKAVRNWBGPDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20ClN/c1-5-9(11(3)4)6-8(2)7-10/h8-9H,5-7H2,1-4H3.
What are the key properties of 6-chloro-N,N,5-trimethylhexan-3-amine?
6-chloro-N,N,5-trimethylhexan-3-amine has a molecular weight of 177.72 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,N,5-trimethylhexan-3-amine is sourced from PubChem (CID 88740860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).