About 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione
5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione (PubChem CID 88741527) has the molecular formula C23H15NO3
and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione.
Molecular Properties
| Compound Name | 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione |
| PubChem CID | 88741527 |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione |
| SMILES | CN1C(=O)C(c2ccccc2)=c2cc3c(cc21)=C(c1ccccc1)C(=O)O3 |
| InChI | InChI=1S/C23H15NO3/c1-24-18-12-17-19(27-23(26)21(17)15-10-6-3-7-11-15)13-16(18)20(22(24)25)14-8-4-2-5-9-14/h2-13H,1H3 |
| InChIKey | SHHSYCYPARTIPY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
The IUPAC name of 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione (CID 88741527) is 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione.
What is the SMILES notation for 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
The canonical SMILES for 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione is CN1C(=O)C(c2ccccc2)=c2cc3c(cc21)=C(c1ccccc1)C(=O)O3.
What is the InChIKey of 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
The InChIKey is SHHSYCYPARTIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15NO3/c1-24-18-12-17-19(27-23(26)21(17)15-10-6-3-7-11-15)13-16(18)20(22(24)25)14-8-4-2-5-9-14/h2-13H,1H3.
What are the key properties of 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione?
5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione has a molecular weight of 353.38 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,7-diphenylfuro[2,3-f]indole-2,6-dione is sourced from PubChem (CID 88741527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).