C13H15NO9 — CID 88741742
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[nitro(phenyl)methoxy]oxane-2-carboxylic acid (PubChem CID 88741742) has the molecular formula C13H15NO9 and a molecular weight of 329.26 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[nitro(phenyl)methoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[nitro(phenyl)methoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 88741742 |
| Molecular Formula | C13H15NO9 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[nitro(phenyl)methoxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1OC(OC(c2ccccc2)[N+](=O)[O-])[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15NO9/c15-7-8(16)10(12(18)19)22-13(9(7)17)23-11(14(20)21)6-4-2-1-3-5-6/h1-5,7-11,13,15-17H,(H,18,19)/t7-,8-,9+,10-,11?,13?/m0/s1 |
| InChIKey | WFGPNMXFPHTHQV-WAIGUJNRSA-N |
| XLogP | -1.13 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|