C14H21NO8S2 — CID 88741840
[1-(2,7-dimethyl-3,4-dihydro-2H-quinolin-1-yl)-3-sulfooxypropan-2-yl] hydrogen sulfate (PubChem CID 88741840) has the molecular formula C14H21NO8S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is [1-(2,7-dimethyl-3,4-dihydro-2H-quinolin-1-yl)-3-sulfooxypropan-2-yl] hydrogen sulfate.
| Compound Name | [1-(2,7-dimethyl-3,4-dihydro-2H-quinolin-1-yl)-3-sulfooxypropan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 88741840 |
| Molecular Formula | C14H21NO8S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [1-(2,7-dimethyl-3,4-dihydro-2H-quinolin-1-yl)-3-sulfooxypropan-2-yl] hydrogen sulfate |
| SMILES | Cc1ccc2c(c1)N(CC(COS(=O)(=O)O)OS(=O)(=O)O)C(C)CC2 |
| InChI | InChI=1S/C14H21NO8S2/c1-10-3-5-12-6-4-11(2)15(14(12)7-10)8-13(23-25(19,20)21)9-22-24(16,17)18/h3,5,7,11,13H,4,6,8-9H2,1-2H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | AGXGTMRRNNPLFH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|