About (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate
(2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88741968) has the molecular formula C16H17Cl3O2
and a molecular weight of 347.67 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 88741968 |
| Molecular Formula | C16H17Cl3O2 |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | Cc1cccc(Cl)c1COC(=O)C1C(C=C(Cl)Cl)C1(C)C |
| InChI | InChI=1S/C16H17Cl3O2/c1-9-5-4-6-12(17)10(9)8-21-15(20)14-11(7-13(18)19)16(14,2)3/h4-7,11,14H,8H2,1-3H3 |
| InChIKey | CIWZOFKHAGKDSQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CID 88741968) is (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate is Cc1cccc(Cl)c1COC(=O)C1C(C=C(Cl)Cl)C1(C)C.
What is the InChIKey of (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is CIWZOFKHAGKDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl3O2/c1-9-5-4-6-12(17)10(9)8-21-15(20)14-11(7-13(18)19)16(14,2)3/h4-7,11,14H,8H2,1-3H3.
What are the key properties of (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate?
(2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 347.67 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-6-methylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 88741968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).