About palladium;bis(trioctylphosphanium)
palladium;bis(trioctylphosphanium) (PubChem CID 88742312) has the molecular formula C48H104P2Pd+2
and a molecular weight of 849.73 g/mol. Its IUPAC name is palladium;bis(trioctylphosphanium).
Molecular Properties
| Compound Name | palladium;bis(trioctylphosphanium) |
| PubChem CID | 88742312 |
| Molecular Formula | C48H104P2Pd+2 |
| Molecular Weight | 849.73 g/mol |
| Exact Mass | 848.66 |
| IUPAC Name | palladium;bis(trioctylphosphanium) |
| SMILES | CCCCCCCC[PH+](CCCCCCCC)CCCCCCCC.CCCCCCCC[PH+](CCCCCCCC)CCCCCCCC.[Pd] |
| InChI | InChI=1S/2C24H51P.Pd/c2*1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h2*4-24H2,1-3H3;/p+2 |
| InChIKey | MOLCVPNNEWNCJD-UHFFFAOYSA-P |
| XLogP | 18.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 42 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 849.73 |
| LogP ≤ 5 | 18.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;bis(trioctylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(trioctylphosphanium)?
The IUPAC name of palladium;bis(trioctylphosphanium) (CID 88742312) is palladium;bis(trioctylphosphanium).
What is the SMILES notation for palladium;bis(trioctylphosphanium)?
The canonical SMILES for palladium;bis(trioctylphosphanium) is CCCCCCCC[PH+](CCCCCCCC)CCCCCCCC.CCCCCCCC[PH+](CCCCCCCC)CCCCCCCC.[Pd].
What is the InChIKey of palladium;bis(trioctylphosphanium)?
The InChIKey is MOLCVPNNEWNCJD-UHFFFAOYSA-P. The full InChI is InChI=1S/2C24H51P.Pd/c2*1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h2*4-24H2,1-3H3;/p+2.
What are the key properties of palladium;bis(trioctylphosphanium)?
palladium;bis(trioctylphosphanium) has a molecular weight of 849.73 g/mol, XLogP of 18.56, 42 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(trioctylphosphanium) is sourced from PubChem (CID 88742312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).