About 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride
4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride (PubChem CID 88742427) has the molecular formula C18H22ClF2O7PS2
and a molecular weight of 518.92 g/mol. Its IUPAC name is 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride |
| PubChem CID | 88742427 |
| Molecular Formula | C18H22ClF2O7PS2 |
| Molecular Weight | 518.92 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride |
| SMILES | CCOP(=O)(Cc1ccc(S(=O)(=O)F)cc1)OCC.O=S(=O)(F)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C11H16FO5PS.C7H6ClFO2S/c1-3-16-18(13,17-4-2)9-10-5-7-11(8-6-10)19(12,14)15;8-5-6-1-3-7(4-2-6)12(9,10)11/h5-8H,3-4,9H2,1-2H3;1-4H,5H2 |
| InChIKey | QTZMRUCJEJBPQG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride?
The IUPAC name of 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride (CID 88742427) is 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride.
What is the SMILES notation for 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride?
The canonical SMILES for 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride is CCOP(=O)(Cc1ccc(S(=O)(=O)F)cc1)OCC.O=S(=O)(F)c1ccc(CCl)cc1.
What is the InChIKey of 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride?
The InChIKey is QTZMRUCJEJBPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FO5PS.C7H6ClFO2S/c1-3-16-18(13,17-4-2)9-10-5-7-11(8-6-10)19(12,14)15;8-5-6-1-3-7(4-2-6)12(9,10)11/h5-8H,3-4,9H2,1-2H3;1-4H,5H2.
What are the key properties of 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride?
4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride has a molecular weight of 518.92 g/mol, XLogP of 5.19, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)benzenesulfonyl fluoride;4-(diethoxyphosphorylmethyl)benzenesulfonyl fluoride is sourced from PubChem (CID 88742427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).