C12H22F3N2O6PS — CID 88742601
2-[[ethylsulfanyl-phosphono-(propan-2-ylamino)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 88742601) has the molecular formula C12H22F3N2O6PS and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-[[ethylsulfanyl-phosphono-(propan-2-ylamino)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | 2-[[ethylsulfanyl-phosphono-(propan-2-ylamino)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 88742601 |
| Molecular Formula | C12H22F3N2O6PS |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[[ethylsulfanyl-phosphono-(propan-2-ylamino)methyl]-(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | CCSC(NC(C)C)(N(C(=O)C(F)(F)F)C(CC)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H22F3N2O6PS/c1-5-8(9(18)19)17(10(20)11(13,14)15)12(25-6-2,16-7(3)4)24(21,22)23/h7-8,16H,5-6H2,1-4H3,(H,18,19)(H2,21,22,23) |
| InChIKey | GGVRWJIBIWPFLC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|