C10H20O9 — CID 88742997
acetic acid;acetyl ethaneperoxoate;2-(2-hydroxyethoxy)ethanol (PubChem CID 88742997) has the molecular formula C10H20O9 and a molecular weight of 284.26 g/mol. Its IUPAC name is acetic acid;acetyl ethaneperoxoate;2-(2-hydroxyethoxy)ethanol.
| Compound Name | acetic acid;acetyl ethaneperoxoate;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 88742997 |
| Molecular Formula | C10H20O9 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | acetic acid;acetyl ethaneperoxoate;2-(2-hydroxyethoxy)ethanol |
| SMILES | CC(=O)O.CC(=O)OOC(C)=O.OCCOCCO |
| InChI | InChI=1S/C4H6O4.C4H10O3.C2H4O2/c1-3(5)7-8-4(2)6;5-1-3-7-4-2-6;1-2(3)4/h1-2H3;5-6H,1-4H2;1H3,(H,3,4) |
| InChIKey | SHSZYTXTORVQSK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|