About 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid
5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid (PubChem CID 88743011) has the molecular formula C15H7ClF6O3
and a molecular weight of 384.66 g/mol. Its IUPAC name is 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid |
| PubChem CID | 88743011 |
| Molecular Formula | C15H7ClF6O3 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid |
| SMILES | Cc1c(F)c(F)c(Oc2ccc(C(F)(F)F)c(C(=O)O)c2)c(Cl)c1F |
| InChI | InChI=1S/C15H7ClF6O3/c1-5-10(17)9(16)13(12(19)11(5)18)25-6-2-3-8(15(20,21)22)7(4-6)14(23)24/h2-4H,1H3,(H,23,24) |
| InChIKey | HFVGPVPXUSTGEQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid?
The IUPAC name of 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid (CID 88743011) is 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid?
The canonical SMILES for 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid is Cc1c(F)c(F)c(Oc2ccc(C(F)(F)F)c(C(=O)O)c2)c(Cl)c1F.
What is the InChIKey of 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid?
The InChIKey is HFVGPVPXUSTGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7ClF6O3/c1-5-10(17)9(16)13(12(19)11(5)18)25-6-2-3-8(15(20,21)22)7(4-6)14(23)24/h2-4H,1H3,(H,23,24).
What are the key properties of 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid?
5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid has a molecular weight of 384.66 g/mol, XLogP of 5.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-3,5,6-trifluoro-4-methylphenoxy)-2-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 88743011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).