C15H28N2O — CID 88743404
(NE)-N-[(4E,8E)-11-(ethylamino)-2,2-dimethylundeca-4,8-dienylidene]hydroxylamine (PubChem CID 88743404) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (NE)-N-[(4E,8E)-11-(ethylamino)-2,2-dimethylundeca-4,8-dienylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4E,8E)-11-(ethylamino)-2,2-dimethylundeca-4,8-dienylidene]hydroxylamine |
|---|---|
| PubChem CID | 88743404 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (NE)-N-[(4E,8E)-11-(ethylamino)-2,2-dimethylundeca-4,8-dienylidene]hydroxylamine |
| SMILES | CCNCC/C=C/CC/C=C/CC(C)(C)/C=N/O |
| InChI | InChI=1S/C15H28N2O/c1-4-16-13-11-9-7-5-6-8-10-12-15(2,3)14-17-18/h7-10,14,16,18H,4-6,11-13H2,1-3H3/b9-7+,10-8+,17-14+ |
| InChIKey | QRWHIRJDLUKOIT-SRJONFNDSA-N |
| XLogP | 3.75 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|