C14H12ClNO4 — CID 88743414
(3-amino-5-chloro-2,4-dihydroxyphenyl)-(4-methoxyphenyl)methanone (PubChem CID 88743414) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is (3-amino-5-chloro-2,4-dihydroxyphenyl)-(4-methoxyphenyl)methanone.
| Compound Name | (3-amino-5-chloro-2,4-dihydroxyphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 88743414 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (3-amino-5-chloro-2,4-dihydroxyphenyl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc(Cl)c(O)c(N)c2O)cc1 |
| InChI | InChI=1S/C14H12ClNO4/c1-20-8-4-2-7(3-5-8)12(17)9-6-10(15)14(19)11(16)13(9)18/h2-6,18-19H,16H2,1H3 |
| InChIKey | ZUYGGHOVNQTODO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|