C14H13BrFN2O2+ — CID 88744014
2-(5-amino-4-bromo-2-fluorophenyl)-1-oxo-4,5,6,7-tetrahydro-2H-indol-1-ium-3-one (PubChem CID 88744014) has the molecular formula C14H13BrFN2O2+ and a molecular weight of 340.17 g/mol. Its IUPAC name is 2-(5-amino-4-bromo-2-fluorophenyl)-1-oxo-4,5,6,7-tetrahydro-2H-indol-1-ium-3-one.
| Compound Name | 2-(5-amino-4-bromo-2-fluorophenyl)-1-oxo-4,5,6,7-tetrahydro-2H-indol-1-ium-3-one |
|---|---|
| PubChem CID | 88744014 |
| Molecular Formula | C14H13BrFN2O2+ |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-(5-amino-4-bromo-2-fluorophenyl)-1-oxo-4,5,6,7-tetrahydro-2H-indol-1-ium-3-one |
| SMILES | Nc1cc(C2C(=O)C3=C(CCCC3)[N+]2=O)c(F)cc1Br |
| InChI | InChI=1S/C14H13BrFN2O2/c15-9-6-10(16)8(5-11(9)17)13-14(19)7-3-1-2-4-12(7)18(13)20/h5-6,13H,1-4,17H2/q+1 |
| InChIKey | HVDHBVHLZDUMDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|