About 3-(pentylamino)propanoic acid;hydrochloride
3-(pentylamino)propanoic acid;hydrochloride (PubChem CID 88744045) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is 3-(pentylamino)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-(pentylamino)propanoic acid;hydrochloride |
| PubChem CID | 88744045 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(pentylamino)propanoic acid;hydrochloride |
| SMILES | CCCCCNCCC(=O)O.Cl |
| InChI | InChI=1S/C8H17NO2.ClH/c1-2-3-4-6-9-7-5-8(10)11;/h9H,2-7H2,1H3,(H,10,11);1H |
| InChIKey | CXFOIGXSVZQQJV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(pentylamino)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pentylamino)propanoic acid;hydrochloride?
The IUPAC name of 3-(pentylamino)propanoic acid;hydrochloride (CID 88744045) is 3-(pentylamino)propanoic acid;hydrochloride.
What is the SMILES notation for 3-(pentylamino)propanoic acid;hydrochloride?
The canonical SMILES for 3-(pentylamino)propanoic acid;hydrochloride is CCCCCNCCC(=O)O.Cl.
What is the InChIKey of 3-(pentylamino)propanoic acid;hydrochloride?
The InChIKey is CXFOIGXSVZQQJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.ClH/c1-2-3-4-6-9-7-5-8(10)11;/h9H,2-7H2,1H3,(H,10,11);1H.
What are the key properties of 3-(pentylamino)propanoic acid;hydrochloride?
3-(pentylamino)propanoic acid;hydrochloride has a molecular weight of 195.69 g/mol, XLogP of 1.66, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pentylamino)propanoic acid;hydrochloride is sourced from PubChem (CID 88744045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).