C16H28BrClO2 — CID 88744708
1-bromo-8-chloro-6,13-dimethyltetradeca-1,12-diene-2,9-diol (PubChem CID 88744708) has the molecular formula C16H28BrClO2 and a molecular weight of 367.76 g/mol. Its IUPAC name is 1-bromo-8-chloro-6,13-dimethyltetradeca-1,12-diene-2,9-diol.
| Compound Name | 1-bromo-8-chloro-6,13-dimethyltetradeca-1,12-diene-2,9-diol |
|---|---|
| PubChem CID | 88744708 |
| Molecular Formula | C16H28BrClO2 |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-bromo-8-chloro-6,13-dimethyltetradeca-1,12-diene-2,9-diol |
| SMILES | CC(C)=CCCC(O)C(Cl)CC(C)CCCC(O)=CBr |
| InChI | InChI=1S/C16H28BrClO2/c1-12(2)6-4-9-16(20)15(18)10-13(3)7-5-8-14(19)11-17/h6,11,13,15-16,19-20H,4-5,7-10H2,1-3H3 |
| InChIKey | YKXOBYFFMTXXAC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|