About dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate
dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate (PubChem CID 88745082) has the molecular formula C10H16O6Si
and a molecular weight of 260.32 g/mol. Its IUPAC name is dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate.
Molecular Properties
| Compound Name | dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate |
| PubChem CID | 88745082 |
| Molecular Formula | C10H16O6Si |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1(CC2CO2)CC1.O=[Si](O)O |
| InChI | InChI=1S/C10H14O3.H2O3Si/c1-7(9(11)12-2)10(3-4-10)5-8-6-13-8;1-4(2)3/h8H,1,3-6H2,2H3;1-2H |
| InChIKey | ONVBVXDSQCOTGK-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate?
The IUPAC name of dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate (CID 88745082) is dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate.
What is the SMILES notation for dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate?
The canonical SMILES for dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate is C=C(C(=O)OC)C1(CC2CO2)CC1.O=[Si](O)O.
What is the InChIKey of dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate?
The InChIKey is ONVBVXDSQCOTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3.H2O3Si/c1-7(9(11)12-2)10(3-4-10)5-8-6-13-8;1-4(2)3/h8H,1,3-6H2,2H3;1-2H.
What are the key properties of dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate?
dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate has a molecular weight of 260.32 g/mol, XLogP of -0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)silane;methyl 2-[1-(oxiran-2-ylmethyl)cyclopropyl]prop-2-enoate is sourced from PubChem (CID 88745082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).