About 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea
1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea (PubChem CID 88745121) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea.
Molecular Properties
| Compound Name | 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea |
| PubChem CID | 88745121 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(C)C(=S)N(C)CC=C |
| InChI | InChI=1S/C9H16N2S/c1-5-7-10(3)9(12)11(4)8-6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | CYUHRPAODOVFLD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea?
The IUPAC name of 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea (CID 88745121) is 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea.
What is the SMILES notation for 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea?
The canonical SMILES for 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea is C=CCN(C)C(=S)N(C)CC=C.
What is the InChIKey of 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea?
The InChIKey is CYUHRPAODOVFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-5-7-10(3)9(12)11(4)8-6-2/h5-6H,1-2,7-8H2,3-4H3.
What are the key properties of 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea?
1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea has a molecular weight of 184.31 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1,3-bis(prop-2-enyl)thiourea is sourced from PubChem (CID 88745121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).