N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride

C7H14ClNO3S — CID 88745227

IUPACN-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride
SMILESCN(CC1(C)CCCO1)S(=O)(=O)Cl
InChIInChI=1S/C7H14ClNO3S/c1-7(4-3-5-12-7)6-9(2)13(8,10)11/h3-6H2,1-2H3
InChIKeyOCTIGPCGWXRSPL-UHFFFAOYSA-N
MW227.71 g/mol
LogP0.97
Rot. Bonds3

About N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride

N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride (PubChem CID 88745227) has the molecular formula C7H14ClNO3S and a molecular weight of 227.71 g/mol. Its IUPAC name is N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride.

Molecular Properties

Compound NameN-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride
PubChem CID88745227
Molecular FormulaC7H14ClNO3S
Molecular Weight227.71 g/mol
Exact Mass227.04
IUPAC NameN-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride
SMILESCN(CC1(C)CCCO1)S(=O)(=O)Cl
InChIInChI=1S/C7H14ClNO3S/c1-7(4-3-5-12-7)6-9(2)13(8,10)11/h3-6H2,1-2H3
InChIKeyOCTIGPCGWXRSPL-UHFFFAOYSA-N
XLogP0.97
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.71
LogP ≤ 50.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride?
The IUPAC name of N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride (CID 88745227) is N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride.
What is the SMILES notation for N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride?
The canonical SMILES for N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride is CN(CC1(C)CCCO1)S(=O)(=O)Cl.
What is the InChIKey of N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride?
The InChIKey is OCTIGPCGWXRSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO3S/c1-7(4-3-5-12-7)6-9(2)13(8,10)11/h3-6H2,1-2H3.
What are the key properties of N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride?
N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride has a molecular weight of 227.71 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(2-methyloxolan-2-yl)methyl]sulfamoyl chloride is sourced from PubChem (CID 88745227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).