About 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile
1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile (PubChem CID 88745339) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile |
| PubChem CID | 88745339 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile |
| SMILES | C=CC#N.C=CN1CCCC1=O.C=CN=C=O |
| InChI | InChI=1S/C6H9NO.C3H3NO.C3H3N/c1-2-7-5-3-4-6(7)8;1-2-4-3-5;1-2-3-4/h2H,1,3-5H2;2H,1H2;2H,1H2 |
| InChIKey | BHGFONHFACXOMG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile?
The IUPAC name of 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile (CID 88745339) is 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile is C=CC#N.C=CN1CCCC1=O.C=CN=C=O.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile?
The InChIKey is BHGFONHFACXOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C3H3NO.C3H3N/c1-2-7-5-3-4-6(7)8;1-2-4-3-5;1-2-3-4/h2H,1,3-5H2;2H,1H2;2H,1H2.
What are the key properties of 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile?
1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile has a molecular weight of 233.27 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;isocyanatoethene;prop-2-enenitrile is sourced from PubChem (CID 88745339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).