About 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate
4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate (PubChem CID 88746247) has the molecular formula C19H22F3NO4S
and a molecular weight of 417.45 g/mol. Its IUPAC name is 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate |
| PubChem CID | 88746247 |
| Molecular Formula | C19H22F3NO4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SCCCC(=O)OC(=O)[C@@]1(Cc2cccc(C(F)(F)F)c2)CCCN1 |
| InChI | InChI=1S/C19H22F3NO4S/c1-13(24)28-10-3-7-16(25)27-17(26)18(8-4-9-23-18)12-14-5-2-6-15(11-14)19(20,21)22/h2,5-6,11,23H,3-4,7-10,12H2,1H3/t18-/m0/s1 |
| InChIKey | MXIYGFQFWOVAAA-SFHVURJKSA-N |
| XLogP | 3.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate?
The IUPAC name of 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate (CID 88746247) is 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate?
The canonical SMILES for 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate is CC(=O)SCCCC(=O)OC(=O)[C@@]1(Cc2cccc(C(F)(F)F)c2)CCCN1.
What is the InChIKey of 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate?
The InChIKey is MXIYGFQFWOVAAA-SFHVURJKSA-N. The full InChI is InChI=1S/C19H22F3NO4S/c1-13(24)28-10-3-7-16(25)27-17(26)18(8-4-9-23-18)12-14-5-2-6-15(11-14)19(20,21)22/h2,5-6,11,23H,3-4,7-10,12H2,1H3/t18-/m0/s1.
What are the key properties of 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate?
4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate has a molecular weight of 417.45 g/mol, XLogP of 3.50, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetylsulfanylbutanoyl (2S)-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 88746247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).