About 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid
2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid (PubChem CID 88746436) has the molecular formula C13H11NO4S
and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid.
Molecular Properties
| Compound Name | 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid |
| PubChem CID | 88746436 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid |
| SMILES | O=S(=O)(O)C1(c2ccccc2)Nc2ccccc2O1 |
| InChI | InChI=1S/C13H11NO4S/c15-19(16,17)13(10-6-2-1-3-7-10)14-11-8-4-5-9-12(11)18-13/h1-9,14H,(H,15,16,17) |
| InChIKey | SCHJIRJJOJMCRZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid?
The IUPAC name of 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid (CID 88746436) is 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid.
What is the SMILES notation for 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid?
The canonical SMILES for 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid is O=S(=O)(O)C1(c2ccccc2)Nc2ccccc2O1.
What is the InChIKey of 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid?
The InChIKey is SCHJIRJJOJMCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO4S/c15-19(16,17)13(10-6-2-1-3-7-10)14-11-8-4-5-9-12(11)18-13/h1-9,14H,(H,15,16,17).
What are the key properties of 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid?
2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid has a molecular weight of 277.30 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3H-1,3-benzoxazole-2-sulfonic acid is sourced from PubChem (CID 88746436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).