C20H10Na2O9S2 — CID 88746450
disodium;9,10-dioxo-2-phenoxyanthracene-1,3-disulfonate (PubChem CID 88746450) has the molecular formula C20H10Na2O9S2 and a molecular weight of 504.41 g/mol. Its IUPAC name is disodium;9,10-dioxo-2-phenoxyanthracene-1,3-disulfonate.
| Compound Name | disodium;9,10-dioxo-2-phenoxyanthracene-1,3-disulfonate |
|---|---|
| PubChem CID | 88746450 |
| Molecular Formula | C20H10Na2O9S2 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | disodium;9,10-dioxo-2-phenoxyanthracene-1,3-disulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)[O-])c(Oc1ccccc1)c2S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H12O9S2.2Na/c21-17-12-8-4-5-9-13(12)18(22)16-14(17)10-15(30(23,24)25)19(20(16)31(26,27)28)29-11-6-2-1-3-7-11;;/h1-10H,(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2 |
| InChIKey | BEMVGXHQXLRVMC-UHFFFAOYSA-L |
| XLogP | -3.93 |
| TPSA | 157.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|