C10H10F6O2 — CID 88746518
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexa-2,4-dien-1-ol (PubChem CID 88746518) has the molecular formula C10H10F6O2 and a molecular weight of 276.18 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexa-2,4-dien-1-ol.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 88746518 |
| Molecular Formula | C10H10F6O2 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1(O)C=CC(C(O)(C(F)(F)F)C(F)(F)F)=CC1 |
| InChI | InChI=1S/C10H10F6O2/c1-7(17)4-2-6(3-5-7)8(18,9(11,12)13)10(14,15)16/h2-4,17-18H,5H2,1H3 |
| InChIKey | YLNWZVDGUMTGRZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |