About N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide
N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide (PubChem CID 88746677) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide |
| PubChem CID | 88746677 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC/C=N/CCN.C=C(C)C(N)=O |
| InChI | InChI=1S/C8H15N3O.C4H7NO/c1-7(2)8(12)11-6-5-10-4-3-9;1-3(2)4(5)6/h5H,1,3-4,6,9H2,2H3,(H,11,12);1H2,2H3,(H2,5,6)/b10-5+; |
| InChIKey | FMMQRVXXBGRZGW-OAZHBLANSA-N |
| XLogP | -0.24 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide?
The IUPAC name of N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide (CID 88746677) is N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide.
What is the SMILES notation for N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide?
The canonical SMILES for N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide is C=C(C)C(=O)NC/C=N/CCN.C=C(C)C(N)=O.
What is the InChIKey of N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide?
The InChIKey is FMMQRVXXBGRZGW-OAZHBLANSA-N. The full InChI is InChI=1S/C8H15N3O.C4H7NO/c1-7(2)8(12)11-6-5-10-4-3-9;1-3(2)4(5)6/h5H,1,3-4,6,9H2,2H3,(H,11,12);1H2,2H3,(H2,5,6)/b10-5+;.
What are the key properties of N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide?
N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide has a molecular weight of 254.33 g/mol, XLogP of -0.24, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-aminoethylimino)ethyl]-2-methylprop-2-enamide;2-methylprop-2-enamide is sourced from PubChem (CID 88746677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).