C25H37ClO4 — CID 88746780
CID 88746780 (PubChem CID 88746780) has the molecular formula C25H37ClO4 and a molecular weight of 437.02 g/mol.
| Compound Name | CID 88746780 |
|---|---|
| PubChem CID | 88746780 |
| Molecular Formula | C25H37ClO4 |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4CC5(CCC43CC=CCl)OCCO5)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C25H37ClO4/c1-22-8-5-21-19(20(22)6-9-25(22)29-15-16-30-25)4-3-18-17-24(27-13-14-28-24)11-10-23(18,21)7-2-12-26/h2,12,18-21H,3-11,13-17H2,1H3/t18-,19-,20-,21-,22-,23?/m0/s1 |
| InChIKey | UNWNAFBOEJDQGE-BMIGLNFHSA-N |
| XLogP | 5.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |